C16H14Br2N2O — CID 95910813
4,6-dibromo-2-(2,4-dimethylphenyl)-7-methyl-1,3-benzoxazol-5-amine (PubChem CID 95910813) has the molecular formula C16H14Br2N2O and a molecular weight of 410.11 g/mol. Its IUPAC name is 4,6-dibromo-2-(2,4-dimethylphenyl)-7-methyl-1,3-benzoxazol-5-amine.
| Compound Name | 4,6-dibromo-2-(2,4-dimethylphenyl)-7-methyl-1,3-benzoxazol-5-amine |
|---|---|
| PubChem CID | 95910813 |
| Molecular Formula | C16H14Br2N2O |
| Molecular Weight | 410.11 g/mol |
| Exact Mass | 407.95 |
| IUPAC Name | 4,6-dibromo-2-(2,4-dimethylphenyl)-7-methyl-1,3-benzoxazol-5-amine |
| SMILES | Cc1ccc(-c2nc3c(Br)c(N)c(Br)c(C)c3o2)c(C)c1 |
| InChI | InChI=1S/C16H14Br2N2O/c1-7-4-5-10(8(2)6-7)16-20-14-12(18)13(19)11(17)9(3)15(14)21-16/h4-6H,19H2,1-3H3 |
| InChIKey | NOYVUGZETIADHS-UHFFFAOYSA-N |
| XLogP | 5.53 |
| TPSA | 52.05 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 21 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 410.11 |
| LogP ≤ 5 | 5.53 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|