C17H16Br2N2O — CID 95910801
4,6-dibromo-7-methyl-2-(4-propan-2-ylphenyl)-1,3-benzoxazol-5-amine (PubChem CID 95910801) has the molecular formula C17H16Br2N2O and a molecular weight of 424.14 g/mol. Its IUPAC name is 4,6-dibromo-7-methyl-2-(4-propan-2-ylphenyl)-1,3-benzoxazol-5-amine.
| Compound Name | 4,6-dibromo-7-methyl-2-(4-propan-2-ylphenyl)-1,3-benzoxazol-5-amine |
|---|---|
| PubChem CID | 95910801 |
| Molecular Formula | C17H16Br2N2O |
| Molecular Weight | 424.14 g/mol |
| Exact Mass | 421.96 |
| IUPAC Name | 4,6-dibromo-7-methyl-2-(4-propan-2-ylphenyl)-1,3-benzoxazol-5-amine |
| SMILES | Cc1c(Br)c(N)c(Br)c2nc(-c3ccc(C(C)C)cc3)oc12 |
| InChI | InChI=1S/C17H16Br2N2O/c1-8(2)10-4-6-11(7-5-10)17-21-15-13(19)14(20)12(18)9(3)16(15)22-17/h4-8H,20H2,1-3H3 |
| InChIKey | IDYANYVOQXQZRU-UHFFFAOYSA-N |
| XLogP | 6.03 |
| TPSA | 52.05 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 22 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 424.14 |
| LogP ≤ 5 | 6.03 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|