C18H19NO — CID 95910925
6,7-dimethyl-2-(4-propan-2-ylphenyl)-1,3-benzoxazole (PubChem CID 95910925) has the molecular formula C18H19NO and a molecular weight of 265.36 g/mol. Its IUPAC name is 6,7-dimethyl-2-(4-propan-2-ylphenyl)-1,3-benzoxazole.
| Compound Name | 6,7-dimethyl-2-(4-propan-2-ylphenyl)-1,3-benzoxazole |
|---|---|
| PubChem CID | 95910925 |
| Molecular Formula | C18H19NO |
| Molecular Weight | 265.36 g/mol |
| Exact Mass | 265.15 |
| IUPAC Name | 6,7-dimethyl-2-(4-propan-2-ylphenyl)-1,3-benzoxazole |
| SMILES | Cc1ccc2nc(-c3ccc(C(C)C)cc3)oc2c1C |
| InChI | InChI=1S/C18H19NO/c1-11(2)14-6-8-15(9-7-14)18-19-16-10-5-12(3)13(4)17(16)20-18/h5-11H,1-4H3 |
| InChIKey | CXOVDSQHDGJFAX-UHFFFAOYSA-N |
| XLogP | 5.24 |
| TPSA | 26.03 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 20 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 265.36 |
| LogP ≤ 5 | 5.24 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |