C11H22N4S — CID 95931545
1,3-di(piperidin-1-yl)thiourea (PubChem CID 95931545) has the molecular formula C11H22N4S and a molecular weight of 242.39 g/mol. Its IUPAC name is 1,3-di(piperidin-1-yl)thiourea.
| Compound Name | 1,3-di(piperidin-1-yl)thiourea |
|---|---|
| PubChem CID | 95931545 |
| Molecular Formula | C11H22N4S |
| Molecular Weight | 242.39 g/mol |
| Exact Mass | 242.16 |
| IUPAC Name | 1,3-di(piperidin-1-yl)thiourea |
| SMILES | S=C(NN1CCCCC1)NN1CCCCC1 |
| InChI | InChI=1S/C11H22N4S/c16-11(12-14-7-3-1-4-8-14)13-15-9-5-2-6-10-15/h1-10H2,(H2,12,13,16) |
| InChIKey | YFILNUHROFSBTQ-UHFFFAOYSA-N |
| XLogP | 1.25 |
| TPSA | 30.54 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 242.39 |
| LogP ≤ 5 | 1.25 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|