C13H14N2O2S2 — CID 95933696
(4S)-4-phenyl-6,7-dihydro-4H-thieno[3,2-c]pyridine-5-sulfonamide (PubChem CID 95933696) has the molecular formula C13H14N2O2S2 and a molecular weight of 294.40 g/mol. Its IUPAC name is (4S)-4-phenyl-6,7-dihydro-4H-thieno[3,2-c]pyridine-5-sulfonamide.
| Compound Name | (4S)-4-phenyl-6,7-dihydro-4H-thieno[3,2-c]pyridine-5-sulfonamide |
|---|---|
| PubChem CID | 95933696 |
| Molecular Formula | C13H14N2O2S2 |
| Molecular Weight | 294.40 g/mol |
| Exact Mass | 294.05 |
| IUPAC Name | (4S)-4-phenyl-6,7-dihydro-4H-thieno[3,2-c]pyridine-5-sulfonamide |
| SMILES | NS(=O)(=O)N1CCc2sccc2[C@@H]1c1ccccc1 |
| InChI | InChI=1S/C13H14N2O2S2/c14-19(16,17)15-8-6-12-11(7-9-18-12)13(15)10-4-2-1-3-5-10/h1-5,7,9,13H,6,8H2,(H2,14,16,17)/t13-/m0/s1 |
| InChIKey | CKFJDPAYWLDTDQ-ZDUSSCGKSA-N |
| XLogP | 1.90 |
| TPSA | 63.40 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 294.40 |
| LogP ≤ 5 | 1.90 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |