C19H16N2O4S2 — CID 42888748
5-(2-nitrophenyl)sulfonyl-4-phenyl-6,7-dihydro-4H-thieno[3,2-c]pyridine (PubChem CID 42888748) has the molecular formula C19H16N2O4S2 and a molecular weight of 400.48 g/mol. Its IUPAC name is 5-(2-nitrophenyl)sulfonyl-4-phenyl-6,7-dihydro-4H-thieno[3,2-c]pyridine.
| Compound Name | 5-(2-nitrophenyl)sulfonyl-4-phenyl-6,7-dihydro-4H-thieno[3,2-c]pyridine |
|---|---|
| PubChem CID | 42888748 |
| Molecular Formula | C19H16N2O4S2 |
| Molecular Weight | 400.48 g/mol |
| Exact Mass | 400.06 |
| IUPAC Name | 5-(2-nitrophenyl)sulfonyl-4-phenyl-6,7-dihydro-4H-thieno[3,2-c]pyridine |
| SMILES | O=[N+]([O-])c1ccccc1S(=O)(=O)N1CCc2sccc2C1c1ccccc1 |
| InChI | InChI=1S/C19H16N2O4S2/c22-21(23)16-8-4-5-9-18(16)27(24,25)20-12-10-17-15(11-13-26-17)19(20)14-6-2-1-3-7-14/h1-9,11,13,19H,10,12H2 |
| InChIKey | GKOPWPSUUWULTA-UHFFFAOYSA-N |
| XLogP | 3.99 |
| TPSA | 80.52 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 400.48 |
| LogP ≤ 5 | 3.99 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|