C20H16ClN3O5S2 — CID 166330936
4-[4-(4-chlorophenyl)-6,7-dihydro-4H-thieno[3,2-c]pyridine-5-carbonyl]-2-nitrobenzenesulfonamide (PubChem CID 166330936) has the molecular formula C20H16ClN3O5S2 and a molecular weight of 477.95 g/mol. Its IUPAC name is 4-[4-(4-chlorophenyl)-6,7-dihydro-4H-thieno[3,2-c]pyridine-5-carbonyl]-2-nitrobenzenesulfonamide.
| Compound Name | 4-[4-(4-chlorophenyl)-6,7-dihydro-4H-thieno[3,2-c]pyridine-5-carbonyl]-2-nitrobenzenesulfonamide |
|---|---|
| PubChem CID | 166330936 |
| Molecular Formula | C20H16ClN3O5S2 |
| Molecular Weight | 477.95 g/mol |
| Exact Mass | 477.02 |
| IUPAC Name | 4-[4-(4-chlorophenyl)-6,7-dihydro-4H-thieno[3,2-c]pyridine-5-carbonyl]-2-nitrobenzenesulfonamide |
| SMILES | NS(=O)(=O)c1ccc(C(=O)N2CCc3sccc3C2c2ccc(Cl)cc2)cc1[N+](=O)[O-] |
| InChI | InChI=1S/C20H16ClN3O5S2/c21-14-4-1-12(2-5-14)19-15-8-10-30-17(15)7-9-23(19)20(25)13-3-6-18(31(22,28)29)16(11-13)24(26)27/h1-6,8,10-11,19H,7,9H2,(H2,22,28,29) |
| InChIKey | DEJYAHGDGYQTKC-UHFFFAOYSA-N |
| XLogP | 3.74 |
| TPSA | 123.61 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 477.95 |
| LogP ≤ 5 | 3.74 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|