C18H25N5O2 — CID 95936437
1-[(1R,3R)-3-methoxy-2,2,3-trimethylcyclobutyl]-3-[[3-(1,2,4-triazol-1-yl)phenyl]methyl]urea (PubChem CID 95936437) has the molecular formula C18H25N5O2 and a molecular weight of 343.43 g/mol. Its IUPAC name is 1-[(1R,3R)-3-methoxy-2,2,3-trimethylcyclobutyl]-3-[[3-(1,2,4-triazol-1-yl)phenyl]methyl]urea.
| Compound Name | 1-[(1R,3R)-3-methoxy-2,2,3-trimethylcyclobutyl]-3-[[3-(1,2,4-triazol-1-yl)phenyl]methyl]urea |
|---|---|
| PubChem CID | 95936437 |
| Molecular Formula | C18H25N5O2 |
| Molecular Weight | 343.43 g/mol |
| Exact Mass | 343.20 |
| IUPAC Name | 1-[(1R,3R)-3-methoxy-2,2,3-trimethylcyclobutyl]-3-[[3-(1,2,4-triazol-1-yl)phenyl]methyl]urea |
| SMILES | CO[C@]1(C)C[C@@H](NC(=O)NCc2cccc(-n3cncn3)c2)C1(C)C |
| InChI | InChI=1S/C18H25N5O2/c1-17(2)15(9-18(17,3)25-4)22-16(24)20-10-13-6-5-7-14(8-13)23-12-19-11-21-23/h5-8,11-12,15H,9-10H2,1-4H3,(H2,20,22,24)/t15-,18-/m1/s1 |
| InChIKey | NUTBJTZBOWCMST-CRAIPNDOSA-N |
| XLogP | 2.27 |
| TPSA | 81.07 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 343.43 |
| LogP ≤ 5 | 2.27 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |