C17H23N3OS — CID 95970998
2-[3-[methyl-[(3R)-2-oxo-1-phenylpiperidin-3-yl]amino]propylsulfanyl]acetonitrile (PubChem CID 95970998) has the molecular formula C17H23N3OS and a molecular weight of 317.46 g/mol. Its IUPAC name is 2-[3-[methyl-[(3R)-2-oxo-1-phenylpiperidin-3-yl]amino]propylsulfanyl]acetonitrile.
| Compound Name | 2-[3-[methyl-[(3R)-2-oxo-1-phenylpiperidin-3-yl]amino]propylsulfanyl]acetonitrile |
|---|---|
| PubChem CID | 95970998 |
| Molecular Formula | C17H23N3OS |
| Molecular Weight | 317.46 g/mol |
| Exact Mass | 317.16 |
| IUPAC Name | 2-[3-[methyl-[(3R)-2-oxo-1-phenylpiperidin-3-yl]amino]propylsulfanyl]acetonitrile |
| SMILES | CN(CCCSCC#N)[C@@H]1CCCN(c2ccccc2)C1=O |
| InChI | InChI=1S/C17H23N3OS/c1-19(11-6-13-22-14-10-18)16-9-5-12-20(17(16)21)15-7-3-2-4-8-15/h2-4,7-8,16H,5-6,9,11-14H2,1H3/t16-/m1/s1 |
| InChIKey | ZFLDDLZLDBTNOZ-MRXNPFEDSA-N |
| XLogP | 2.76 |
| TPSA | 47.34 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 317.46 |
| LogP ≤ 5 | 2.76 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|