C13H23NO2S — CID 95972535
(E)-N-[[(1R,2R)-2-ethylsulfanyl-1-hydroxycyclobutyl]methyl]-2-methylpent-2-enamide (PubChem CID 95972535) has the molecular formula C13H23NO2S and a molecular weight of 257.40 g/mol. Its IUPAC name is (E)-N-[[(1R,2R)-2-ethylsulfanyl-1-hydroxycyclobutyl]methyl]-2-methylpent-2-enamide.
| Compound Name | (E)-N-[[(1R,2R)-2-ethylsulfanyl-1-hydroxycyclobutyl]methyl]-2-methylpent-2-enamide |
|---|---|
| PubChem CID | 95972535 |
| Molecular Formula | C13H23NO2S |
| Molecular Weight | 257.40 g/mol |
| Exact Mass | 257.14 |
| IUPAC Name | (E)-N-[[(1R,2R)-2-ethylsulfanyl-1-hydroxycyclobutyl]methyl]-2-methylpent-2-enamide |
| SMILES | CC/C=C(\C)C(=O)NC[C@]1(O)CC[C@H]1SCC |
| InChI | InChI=1S/C13H23NO2S/c1-4-6-10(3)12(15)14-9-13(16)8-7-11(13)17-5-2/h6,11,16H,4-5,7-9H2,1-3H3,(H,14,15)/b10-6+/t11-,13-/m1/s1 |
| InChIKey | FVBMFJBNPFRJFB-GKIGXUJUSA-N |
| XLogP | 2.11 |
| TPSA | 49.33 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 257.40 |
| LogP ≤ 5 | 2.11 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|