C15H19N3O4 — CID 95974055
methyl 3-[[(2R)-1-carbamoylpiperidine-2-carbonyl]amino]benzoate (PubChem CID 95974055) has the molecular formula C15H19N3O4 and a molecular weight of 305.33 g/mol. Its IUPAC name is methyl 3-[[(2R)-1-carbamoylpiperidine-2-carbonyl]amino]benzoate.
| Compound Name | methyl 3-[[(2R)-1-carbamoylpiperidine-2-carbonyl]amino]benzoate |
|---|---|
| PubChem CID | 95974055 |
| Molecular Formula | C15H19N3O4 |
| Molecular Weight | 305.33 g/mol |
| Exact Mass | 305.14 |
| IUPAC Name | methyl 3-[[(2R)-1-carbamoylpiperidine-2-carbonyl]amino]benzoate |
| SMILES | COC(=O)c1cccc(NC(=O)[C@H]2CCCCN2C(N)=O)c1 |
| InChI | InChI=1S/C15H19N3O4/c1-22-14(20)10-5-4-6-11(9-10)17-13(19)12-7-2-3-8-18(12)15(16)21/h4-6,9,12H,2-3,7-8H2,1H3,(H2,16,21)(H,17,19)/t12-/m1/s1 |
| InChIKey | WRUKNPPTRXRYEB-GFCCVEGCSA-N |
| XLogP | 1.34 |
| TPSA | 101.73 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 305.33 |
| LogP ≤ 5 | 1.34 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |