C15H18BrN3O2 — CID 95974113
(8aS)-7-[(4-bromophenyl)methyl]-2-ethyl-5,6,8,8a-tetrahydroimidazo[1,5-a]pyrazine-1,3-dione (PubChem CID 95974113) has the molecular formula C15H18BrN3O2 and a molecular weight of 352.23 g/mol. Its IUPAC name is (8aS)-7-[(4-bromophenyl)methyl]-2-ethyl-5,6,8,8a-tetrahydroimidazo[1,5-a]pyrazine-1,3-dione.
| Compound Name | (8aS)-7-[(4-bromophenyl)methyl]-2-ethyl-5,6,8,8a-tetrahydroimidazo[1,5-a]pyrazine-1,3-dione |
|---|---|
| PubChem CID | 95974113 |
| Molecular Formula | C15H18BrN3O2 |
| Molecular Weight | 352.23 g/mol |
| Exact Mass | 351.06 |
| IUPAC Name | (8aS)-7-[(4-bromophenyl)methyl]-2-ethyl-5,6,8,8a-tetrahydroimidazo[1,5-a]pyrazine-1,3-dione |
| SMILES | CCN1C(=O)[C@@H]2CN(Cc3ccc(Br)cc3)CCN2C1=O |
| InChI | InChI=1S/C15H18BrN3O2/c1-2-18-14(20)13-10-17(7-8-19(13)15(18)21)9-11-3-5-12(16)6-4-11/h3-6,13H,2,7-10H2,1H3/t13-/m0/s1 |
| InChIKey | GHPBVVDJXPJBPH-ZDUSSCGKSA-N |
| XLogP | 1.92 |
| TPSA | 43.86 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 352.23 |
| LogP ≤ 5 | 1.92 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'hydantoin', 'substructure': 'N/A'} |
|---|