C12H17N5OS — CID 95974307
(8aR)-7-(6-ethylsulfanylpyrazin-2-yl)-1,2,5,6,8,8a-hexahydroimidazo[1,5-a]pyrazin-3-one (PubChem CID 95974307) has the molecular formula C12H17N5OS and a molecular weight of 279.37 g/mol. Its IUPAC name is (8aR)-7-(6-ethylsulfanylpyrazin-2-yl)-1,2,5,6,8,8a-hexahydroimidazo[1,5-a]pyrazin-3-one.
| Compound Name | (8aR)-7-(6-ethylsulfanylpyrazin-2-yl)-1,2,5,6,8,8a-hexahydroimidazo[1,5-a]pyrazin-3-one |
|---|---|
| PubChem CID | 95974307 |
| Molecular Formula | C12H17N5OS |
| Molecular Weight | 279.37 g/mol |
| Exact Mass | 279.12 |
| IUPAC Name | (8aR)-7-(6-ethylsulfanylpyrazin-2-yl)-1,2,5,6,8,8a-hexahydroimidazo[1,5-a]pyrazin-3-one |
| SMILES | CCSc1cncc(N2CCN3C(=O)NC[C@@H]3C2)n1 |
| InChI | InChI=1S/C12H17N5OS/c1-2-19-11-7-13-6-10(15-11)16-3-4-17-9(8-16)5-14-12(17)18/h6-7,9H,2-5,8H2,1H3,(H,14,18)/t9-/m1/s1 |
| InChIKey | KIAPZANNXIRZJU-SECBINFHSA-N |
| XLogP | 0.80 |
| TPSA | 61.36 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 279.37 |
| LogP ≤ 5 | 0.80 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |