C20H25N5OS — CID 133390053
1-[1-(6-benzylsulfanylpyrazin-2-yl)piperidin-4-yl]-1,3-diazinan-2-one (PubChem CID 133390053) has the molecular formula C20H25N5OS and a molecular weight of 383.52 g/mol. Its IUPAC name is 1-[1-(6-benzylsulfanylpyrazin-2-yl)piperidin-4-yl]-1,3-diazinan-2-one.
| Compound Name | 1-[1-(6-benzylsulfanylpyrazin-2-yl)piperidin-4-yl]-1,3-diazinan-2-one |
|---|---|
| PubChem CID | 133390053 |
| Molecular Formula | C20H25N5OS |
| Molecular Weight | 383.52 g/mol |
| Exact Mass | 383.18 |
| IUPAC Name | 1-[1-(6-benzylsulfanylpyrazin-2-yl)piperidin-4-yl]-1,3-diazinan-2-one |
| SMILES | O=C1NCCCN1C1CCN(c2cncc(SCc3ccccc3)n2)CC1 |
| InChI | InChI=1S/C20H25N5OS/c26-20-22-9-4-10-25(20)17-7-11-24(12-8-17)18-13-21-14-19(23-18)27-15-16-5-2-1-3-6-16/h1-3,5-6,13-14,17H,4,7-12,15H2,(H,22,26) |
| InChIKey | YLYSAVMKOFXGIL-UHFFFAOYSA-N |
| XLogP | 3.15 |
| TPSA | 61.36 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 383.52 |
| LogP ≤ 5 | 3.15 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |