C19H19N3OS — CID 133389717
2-benzylsulfanyl-6-[2-(furan-2-yl)pyrrolidin-1-yl]pyrazine (PubChem CID 133389717) has the molecular formula C19H19N3OS and a molecular weight of 337.45 g/mol. Its IUPAC name is 2-benzylsulfanyl-6-[2-(furan-2-yl)pyrrolidin-1-yl]pyrazine.
| Compound Name | 2-benzylsulfanyl-6-[2-(furan-2-yl)pyrrolidin-1-yl]pyrazine |
|---|---|
| PubChem CID | 133389717 |
| Molecular Formula | C19H19N3OS |
| Molecular Weight | 337.45 g/mol |
| Exact Mass | 337.12 |
| IUPAC Name | 2-benzylsulfanyl-6-[2-(furan-2-yl)pyrrolidin-1-yl]pyrazine |
| SMILES | c1ccc(CSc2cncc(N3CCCC3c3ccco3)n2)cc1 |
| InChI | InChI=1S/C19H19N3OS/c1-2-6-15(7-3-1)14-24-19-13-20-12-18(21-19)22-10-4-8-16(22)17-9-5-11-23-17/h1-3,5-7,9,11-13,16H,4,8,10,14H2 |
| InChIKey | TWSAPSKVJDIIGS-UHFFFAOYSA-N |
| XLogP | 4.70 |
| TPSA | 42.16 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 337.45 |
| LogP ≤ 5 | 4.70 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |