C19H25N3OS2 — CID 133479425
4-(6-benzylsulfanylpyrazin-2-yl)-2,2-diethyl-1,4-thiazinane 1-oxide (PubChem CID 133479425) has the molecular formula C19H25N3OS2 and a molecular weight of 375.56 g/mol. Its IUPAC name is 4-(6-benzylsulfanylpyrazin-2-yl)-2,2-diethyl-1,4-thiazinane 1-oxide.
| Compound Name | 4-(6-benzylsulfanylpyrazin-2-yl)-2,2-diethyl-1,4-thiazinane 1-oxide |
|---|---|
| PubChem CID | 133479425 |
| Molecular Formula | C19H25N3OS2 |
| Molecular Weight | 375.56 g/mol |
| Exact Mass | 375.14 |
| IUPAC Name | 4-(6-benzylsulfanylpyrazin-2-yl)-2,2-diethyl-1,4-thiazinane 1-oxide |
| SMILES | CCC1(CC)CN(c2cncc(SCc3ccccc3)n2)CCS1=O |
| InChI | InChI=1S/C19H25N3OS2/c1-3-19(4-2)15-22(10-11-25(19)23)17-12-20-13-18(21-17)24-14-16-8-6-5-7-9-16/h5-9,12-13H,3-4,10-11,14-15H2,1-2H3 |
| InChIKey | NKXNCOXWRANLDW-UHFFFAOYSA-N |
| XLogP | 3.90 |
| TPSA | 46.09 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 375.56 |
| LogP ≤ 5 | 3.90 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |