C24H23N5OS — CID 133389485
[4-(6-benzylsulfanylpyrazin-2-yl)piperazin-1-yl]-(1H-indol-2-yl)methanone (PubChem CID 133389485) has the molecular formula C24H23N5OS and a molecular weight of 429.55 g/mol. Its IUPAC name is [4-(6-benzylsulfanylpyrazin-2-yl)piperazin-1-yl]-(1H-indol-2-yl)methanone.
| Compound Name | [4-(6-benzylsulfanylpyrazin-2-yl)piperazin-1-yl]-(1H-indol-2-yl)methanone |
|---|---|
| PubChem CID | 133389485 |
| Molecular Formula | C24H23N5OS |
| Molecular Weight | 429.55 g/mol |
| Exact Mass | 429.16 |
| IUPAC Name | [4-(6-benzylsulfanylpyrazin-2-yl)piperazin-1-yl]-(1H-indol-2-yl)methanone |
| SMILES | O=C(c1cc2ccccc2[nH]1)N1CCN(c2cncc(SCc3ccccc3)n2)CC1 |
| InChI | InChI=1S/C24H23N5OS/c30-24(21-14-19-8-4-5-9-20(19)26-21)29-12-10-28(11-13-29)22-15-25-16-23(27-22)31-17-18-6-2-1-3-7-18/h1-9,14-16,26H,10-13,17H2 |
| InChIKey | HBACXXRMWOCQQP-UHFFFAOYSA-N |
| XLogP | 4.21 |
| TPSA | 65.12 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 429.55 |
| LogP ≤ 5 | 4.21 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |