C21H19N5O — CID 155951108
1H-indol-2-yl-[4-(1,6-naphthyridin-4-yl)piperazin-1-yl]methanone (PubChem CID 155951108) has the molecular formula C21H19N5O and a molecular weight of 357.42 g/mol. Its IUPAC name is 1H-indol-2-yl-[4-(1,6-naphthyridin-4-yl)piperazin-1-yl]methanone.
| Compound Name | 1H-indol-2-yl-[4-(1,6-naphthyridin-4-yl)piperazin-1-yl]methanone |
|---|---|
| PubChem CID | 155951108 |
| Molecular Formula | C21H19N5O |
| Molecular Weight | 357.42 g/mol |
| Exact Mass | 357.16 |
| IUPAC Name | 1H-indol-2-yl-[4-(1,6-naphthyridin-4-yl)piperazin-1-yl]methanone |
| SMILES | O=C(c1cc2ccccc2[nH]1)N1CCN(c2ccnc3ccncc23)CC1 |
| InChI | InChI=1S/C21H19N5O/c27-21(19-13-15-3-1-2-4-17(15)24-19)26-11-9-25(10-12-26)20-6-8-23-18-5-7-22-14-16(18)20/h1-8,13-14,24H,9-12H2 |
| InChIKey | USEQGLMLLKRSEV-UHFFFAOYSA-N |
| XLogP | 3.07 |
| TPSA | 65.12 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 357.42 |
| LogP ≤ 5 | 3.07 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |