C17H22N4S — CID 133413581
2-benzylsulfanyl-6-(4-ethylpiperazin-1-yl)pyrazine (PubChem CID 133413581) has the molecular formula C17H22N4S and a molecular weight of 314.46 g/mol. Its IUPAC name is 2-benzylsulfanyl-6-(4-ethylpiperazin-1-yl)pyrazine.
| Compound Name | 2-benzylsulfanyl-6-(4-ethylpiperazin-1-yl)pyrazine |
|---|---|
| PubChem CID | 133413581 |
| Molecular Formula | C17H22N4S |
| Molecular Weight | 314.46 g/mol |
| Exact Mass | 314.16 |
| IUPAC Name | 2-benzylsulfanyl-6-(4-ethylpiperazin-1-yl)pyrazine |
| SMILES | CCN1CCN(c2cncc(SCc3ccccc3)n2)CC1 |
| InChI | InChI=1S/C17H22N4S/c1-2-20-8-10-21(11-9-20)16-12-18-13-17(19-16)22-14-15-6-4-3-5-7-15/h3-7,12-13H,2,8-11,14H2,1H3 |
| InChIKey | YLPPBJULFXDWDU-UHFFFAOYSA-N |
| XLogP | 2.91 |
| TPSA | 32.26 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 314.46 |
| LogP ≤ 5 | 2.91 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |