C19H22N6S — CID 133390082
2-benzylsulfanyl-6-[4-(triazol-1-ylmethyl)piperidin-1-yl]pyrazine (PubChem CID 133390082) has the molecular formula C19H22N6S and a molecular weight of 366.49 g/mol. Its IUPAC name is 2-benzylsulfanyl-6-[4-(triazol-1-ylmethyl)piperidin-1-yl]pyrazine.
| Compound Name | 2-benzylsulfanyl-6-[4-(triazol-1-ylmethyl)piperidin-1-yl]pyrazine |
|---|---|
| PubChem CID | 133390082 |
| Molecular Formula | C19H22N6S |
| Molecular Weight | 366.49 g/mol |
| Exact Mass | 366.16 |
| IUPAC Name | 2-benzylsulfanyl-6-[4-(triazol-1-ylmethyl)piperidin-1-yl]pyrazine |
| SMILES | c1ccc(CSc2cncc(N3CCC(Cn4ccnn4)CC3)n2)cc1 |
| InChI | InChI=1S/C19H22N6S/c1-2-4-17(5-3-1)15-26-19-13-20-12-18(22-19)24-9-6-16(7-10-24)14-25-11-8-21-23-25/h1-5,8,11-13,16H,6-7,9-10,14-15H2 |
| InChIKey | XNDOLGYRJCYCOC-UHFFFAOYSA-N |
| XLogP | 3.28 |
| TPSA | 59.73 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 366.49 |
| LogP ≤ 5 | 3.28 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |