C17H20N4OS — CID 133413644
1-(6-benzylsulfanylpyrazin-2-yl)piperidine-3-carboxamide (PubChem CID 133413644) has the molecular formula C17H20N4OS and a molecular weight of 328.44 g/mol. Its IUPAC name is 1-(6-benzylsulfanylpyrazin-2-yl)piperidine-3-carboxamide.
| Compound Name | 1-(6-benzylsulfanylpyrazin-2-yl)piperidine-3-carboxamide |
|---|---|
| PubChem CID | 133413644 |
| Molecular Formula | C17H20N4OS |
| Molecular Weight | 328.44 g/mol |
| Exact Mass | 328.14 |
| IUPAC Name | 1-(6-benzylsulfanylpyrazin-2-yl)piperidine-3-carboxamide |
| SMILES | NC(=O)C1CCCN(c2cncc(SCc3ccccc3)n2)C1 |
| InChI | InChI=1S/C17H20N4OS/c18-17(22)14-7-4-8-21(11-14)15-9-19-10-16(20-15)23-12-13-5-2-1-3-6-13/h1-3,5-6,9-10,14H,4,7-8,11-12H2,(H2,18,22) |
| InChIKey | RSFWHHABJYQCRV-UHFFFAOYSA-N |
| XLogP | 2.47 |
| TPSA | 72.11 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 328.44 |
| LogP ≤ 5 | 2.47 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |