C14H19N3O3S — CID 95981211
methyl 4-[5-[[(1S)-cyclohex-3-ene-1-carbonyl]amino]-1,3,4-thiadiazol-2-yl]butanoate (PubChem CID 95981211) has the molecular formula C14H19N3O3S and a molecular weight of 309.39 g/mol. Its IUPAC name is methyl 4-[5-[[(1S)-cyclohex-3-ene-1-carbonyl]amino]-1,3,4-thiadiazol-2-yl]butanoate.
| Compound Name | methyl 4-[5-[[(1S)-cyclohex-3-ene-1-carbonyl]amino]-1,3,4-thiadiazol-2-yl]butanoate |
|---|---|
| PubChem CID | 95981211 |
| Molecular Formula | C14H19N3O3S |
| Molecular Weight | 309.39 g/mol |
| Exact Mass | 309.11 |
| IUPAC Name | methyl 4-[5-[[(1S)-cyclohex-3-ene-1-carbonyl]amino]-1,3,4-thiadiazol-2-yl]butanoate |
| SMILES | COC(=O)CCCc1nnc(NC(=O)[C@@H]2CC=CCC2)s1 |
| InChI | InChI=1S/C14H19N3O3S/c1-20-12(18)9-5-8-11-16-17-14(21-11)15-13(19)10-6-3-2-4-7-10/h2-3,10H,4-9H2,1H3,(H,15,17,19)/t10-/m1/s1 |
| InChIKey | AOCBUQJJXDOVIJ-SNVBAGLBSA-N |
| XLogP | 2.33 |
| TPSA | 81.18 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 309.39 |
| LogP ≤ 5 | 2.33 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|