C13H14F3N5O2 — CID 95985461
N-[(2S)-1-hydroxybutan-2-yl]-2-[4-(trifluoromethyl)phenyl]tetrazole-5-carboxamide (PubChem CID 95985461) has the molecular formula C13H14F3N5O2 and a molecular weight of 329.28 g/mol. Its IUPAC name is N-[(2S)-1-hydroxybutan-2-yl]-2-[4-(trifluoromethyl)phenyl]tetrazole-5-carboxamide.
| Compound Name | N-[(2S)-1-hydroxybutan-2-yl]-2-[4-(trifluoromethyl)phenyl]tetrazole-5-carboxamide |
|---|---|
| PubChem CID | 95985461 |
| Molecular Formula | C13H14F3N5O2 |
| Molecular Weight | 329.28 g/mol |
| Exact Mass | 329.11 |
| IUPAC Name | N-[(2S)-1-hydroxybutan-2-yl]-2-[4-(trifluoromethyl)phenyl]tetrazole-5-carboxamide |
| SMILES | CC[C@@H](CO)NC(=O)c1nnn(-c2ccc(C(F)(F)F)cc2)n1 |
| InChI | InChI=1S/C13H14F3N5O2/c1-2-9(7-22)17-12(23)11-18-20-21(19-11)10-5-3-8(4-6-10)13(14,15)16/h3-6,9,22H,2,7H2,1H3,(H,17,23)/t9-/m0/s1 |
| InChIKey | TXWCXJTUEDTWEB-VIFPVBQESA-N |
| XLogP | 1.18 |
| TPSA | 92.93 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 329.28 |
| LogP ≤ 5 | 1.18 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |