C15H18N2O5S — CID 95986665
4-(dimethylsulfamoyl)-N-[(2R)-2-(furan-3-yl)-2-hydroxyethyl]benzamide (PubChem CID 95986665) has the molecular formula C15H18N2O5S and a molecular weight of 338.39 g/mol. Its IUPAC name is 4-(dimethylsulfamoyl)-N-[(2R)-2-(furan-3-yl)-2-hydroxyethyl]benzamide.
| Compound Name | 4-(dimethylsulfamoyl)-N-[(2R)-2-(furan-3-yl)-2-hydroxyethyl]benzamide |
|---|---|
| PubChem CID | 95986665 |
| Molecular Formula | C15H18N2O5S |
| Molecular Weight | 338.39 g/mol |
| Exact Mass | 338.09 |
| IUPAC Name | 4-(dimethylsulfamoyl)-N-[(2R)-2-(furan-3-yl)-2-hydroxyethyl]benzamide |
| SMILES | CN(C)S(=O)(=O)c1ccc(C(=O)NC[C@H](O)c2ccoc2)cc1 |
| InChI | InChI=1S/C15H18N2O5S/c1-17(2)23(20,21)13-5-3-11(4-6-13)15(19)16-9-14(18)12-7-8-22-10-12/h3-8,10,14,18H,9H2,1-2H3,(H,16,19)/t14-/m0/s1 |
| InChIKey | KNDWGZIVVODKIZ-AWEZNQCLSA-N |
| XLogP | 0.99 |
| TPSA | 99.85 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 338.39 |
| LogP ≤ 5 | 0.99 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |