C13H16ClNO2S — CID 95988726
(1R)-N-[(2R)-2-(5-chlorothiophen-2-yl)-2-hydroxyethyl]cyclohex-3-ene-1-carboxamide (PubChem CID 95988726) has the molecular formula C13H16ClNO2S and a molecular weight of 285.80 g/mol. Its IUPAC name is (1R)-N-[(2R)-2-(5-chlorothiophen-2-yl)-2-hydroxyethyl]cyclohex-3-ene-1-carboxamide.
| Compound Name | (1R)-N-[(2R)-2-(5-chlorothiophen-2-yl)-2-hydroxyethyl]cyclohex-3-ene-1-carboxamide |
|---|---|
| PubChem CID | 95988726 |
| Molecular Formula | C13H16ClNO2S |
| Molecular Weight | 285.80 g/mol |
| Exact Mass | 285.06 |
| IUPAC Name | (1R)-N-[(2R)-2-(5-chlorothiophen-2-yl)-2-hydroxyethyl]cyclohex-3-ene-1-carboxamide |
| SMILES | O=C(NC[C@@H](O)c1ccc(Cl)s1)[C@H]1CC=CCC1 |
| InChI | InChI=1S/C13H16ClNO2S/c14-12-7-6-11(18-12)10(16)8-15-13(17)9-4-2-1-3-5-9/h1-2,6-7,9-10,16H,3-5,8H2,(H,15,17)/t9-,10+/m0/s1 |
| InChIKey | WXRHFZWZYIRNPH-VHSXEESVSA-N |
| XLogP | 2.91 |
| TPSA | 49.33 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 285.80 |
| LogP ≤ 5 | 2.91 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|