C15H23ClIN3O3S — CID 119139589
methyl 1-[N-[2-(5-chlorothiophen-2-yl)-2-hydroxyethyl]-N'-methylcarbamimidoyl]piperidine-4-carboxylate;hydroiodide (PubChem CID 119139589) has the molecular formula C15H23ClIN3O3S and a molecular weight of 487.79 g/mol. Its IUPAC name is methyl 1-[N-[2-(5-chlorothiophen-2-yl)-2-hydroxyethyl]-N'-methylcarbamimidoyl]piperidine-4-carboxylate;hydroiodide.
| Compound Name | methyl 1-[N-[2-(5-chlorothiophen-2-yl)-2-hydroxyethyl]-N'-methylcarbamimidoyl]piperidine-4-carboxylate;hydroiodide |
|---|---|
| PubChem CID | 119139589 |
| Molecular Formula | C15H23ClIN3O3S |
| Molecular Weight | 487.79 g/mol |
| Exact Mass | 487.02 |
| IUPAC Name | methyl 1-[N-[2-(5-chlorothiophen-2-yl)-2-hydroxyethyl]-N'-methylcarbamimidoyl]piperidine-4-carboxylate;hydroiodide |
| SMILES | C/N=C(\NCC(O)c1ccc(Cl)s1)N1CCC(C(=O)OC)CC1.I |
| InChI | InChI=1S/C15H22ClN3O3S.HI/c1-17-15(18-9-11(20)12-3-4-13(16)23-12)19-7-5-10(6-8-19)14(21)22-2;/h3-4,10-11,20H,5-9H2,1-2H3,(H,17,18);1H |
| InChIKey | LHESQZZKXDAVPQ-UHFFFAOYSA-N |
| XLogP | 2.51 |
| TPSA | 74.16 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 487.79 |
| LogP ≤ 5 | 2.51 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|