C19H25ClIN3O2S — CID 119156196
N-[2-(5-chlorothiophen-2-yl)-2-hydroxyethyl]-3-(4-methoxyphenyl)-N'-methylpyrrolidine-1-carboximidamide;hydroiodide (PubChem CID 119156196) has the molecular formula C19H25ClIN3O2S and a molecular weight of 521.85 g/mol. Its IUPAC name is N-[2-(5-chlorothiophen-2-yl)-2-hydroxyethyl]-3-(4-methoxyphenyl)-N'-methylpyrrolidine-1-carboximidamide;hydroiodide.
| Compound Name | N-[2-(5-chlorothiophen-2-yl)-2-hydroxyethyl]-3-(4-methoxyphenyl)-N'-methylpyrrolidine-1-carboximidamide;hydroiodide |
|---|---|
| PubChem CID | 119156196 |
| Molecular Formula | C19H25ClIN3O2S |
| Molecular Weight | 521.85 g/mol |
| Exact Mass | 521.04 |
| IUPAC Name | N-[2-(5-chlorothiophen-2-yl)-2-hydroxyethyl]-3-(4-methoxyphenyl)-N'-methylpyrrolidine-1-carboximidamide;hydroiodide |
| SMILES | C/N=C(\NCC(O)c1ccc(Cl)s1)N1CCC(c2ccc(OC)cc2)C1.I |
| InChI | InChI=1S/C19H24ClN3O2S.HI/c1-21-19(22-11-16(24)17-7-8-18(20)26-17)23-10-9-14(12-23)13-3-5-15(25-2)6-4-13;/h3-8,14,16,24H,9-12H2,1-2H3,(H,21,22);1H |
| InChIKey | PINFPDQAIJHIJD-UHFFFAOYSA-N |
| XLogP | 4.13 |
| TPSA | 57.09 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 521.85 |
| LogP ≤ 5 | 4.13 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|