C15H19N3O2 — CID 95990031
N-[(2R)-butan-2-yl]-6,7-dimethyl-3-oxo-4H-quinoxaline-2-carboxamide (PubChem CID 95990031) has the molecular formula C15H19N3O2 and a molecular weight of 273.34 g/mol. Its IUPAC name is N-[(2R)-butan-2-yl]-6,7-dimethyl-3-oxo-4H-quinoxaline-2-carboxamide.
| Compound Name | N-[(2R)-butan-2-yl]-6,7-dimethyl-3-oxo-4H-quinoxaline-2-carboxamide |
|---|---|
| PubChem CID | 95990031 |
| Molecular Formula | C15H19N3O2 |
| Molecular Weight | 273.34 g/mol |
| Exact Mass | 273.15 |
| IUPAC Name | N-[(2R)-butan-2-yl]-6,7-dimethyl-3-oxo-4H-quinoxaline-2-carboxamide |
| SMILES | CC[C@@H](C)NC(=O)c1nc2cc(C)c(C)cc2[nH]c1=O |
| InChI | InChI=1S/C15H19N3O2/c1-5-10(4)16-14(19)13-15(20)18-12-7-9(3)8(2)6-11(12)17-13/h6-7,10H,5H2,1-4H3,(H,16,19)(H,18,20)/t10-/m1/s1 |
| InChIKey | OBGJTZLEETZLEQ-SNVBAGLBSA-N |
| XLogP | 2.07 |
| TPSA | 74.85 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 273.34 |
| LogP ≤ 5 | 2.07 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |