C4F10 — CID 9638
1,1,1,2,2,3,3,4,4,4-decafluorobutane (PubChem CID 9638) has the molecular formula C4F10 and a molecular weight of 238.02 g/mol. Its IUPAC name is 1,1,1,2,2,3,3,4,4,4-decafluorobutane.
| Compound Name | 1,1,1,2,2,3,3,4,4,4-decafluorobutane |
|---|---|
| PubChem CID | 9638 |
| Molecular Formula | C4F10 |
| Molecular Weight | 238.02 g/mol |
| Exact Mass | 237.98 |
| IUPAC Name | 1,1,1,2,2,3,3,4,4,4-decafluorobutane |
| SMILES | FC(F)(F)C(F)(F)C(F)(F)C(F)(F)F |
| InChI | InChI=1S/C4F10/c5-1(6,3(9,10)11)2(7,8)4(12,13)14 |
| InChIKey | KAVGMUDTWQVPDF-UHFFFAOYSA-N |
| XLogP | 3.38 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 1 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 238.02 |
| LogP ≤ 5 | 3.38 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|