C5F12 — CID 12675
View drug profile → perflenapent1,1,1,2,2,3,3,4,4,5,5,5-dodecafluoropentane (PubChem CID 12675) has the molecular formula C5F12 and a molecular weight of 288.03 g/mol. Its IUPAC name is 1,1,1,2,2,3,3,4,4,5,5,5-dodecafluoropentane.
| Compound Name | 1,1,1,2,2,3,3,4,4,5,5,5-dodecafluoropentane |
|---|---|
| PubChem CID | 12675 |
| Molecular Formula | C5F12 |
| Molecular Weight | 288.03 g/mol |
| Exact Mass | 287.98 |
| IUPAC Name | 1,1,1,2,2,3,3,4,4,5,5,5-dodecafluoropentane |
| SMILES | FC(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)F |
| InChI | InChI=1S/C5F12/c6-1(7,2(8,9)4(12,13)14)3(10,11)5(15,16)17 |
| InChIKey | NJCBUSHGCBERSK-UHFFFAOYSA-N |
| XLogP | 4.02 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 2 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 288.03 |
| LogP ≤ 5 | 4.02 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|