C4F9Sg- — CID 162268631
1,1,1,2,2,3,3,4,4-nonafluorobutane;seaborgium (PubChem CID 162268631) has the molecular formula C4F9Sg- and a molecular weight of 488.03 g/mol. Its IUPAC name is 1,1,1,2,2,3,3,4,4-nonafluorobutane;seaborgium.
| Compound Name | 1,1,1,2,2,3,3,4,4-nonafluorobutane;seaborgium |
|---|---|
| PubChem CID | 162268631 |
| Molecular Formula | C4F9Sg- |
| Molecular Weight | 488.03 g/mol |
| Exact Mass | 490.12 |
| IUPAC Name | 1,1,1,2,2,3,3,4,4-nonafluorobutane;seaborgium |
| SMILES | F[C-](F)C(F)(F)C(F)(F)C(F)(F)F.[Sg] |
| InChI | InChI=1S/C4F9.Sg/c5-1(6)2(7,8)3(9,10)4(11,12)13;/q-1; |
| InChIKey | NMWYQVDQENXCFD-UHFFFAOYSA-N |
| XLogP | 3.25 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 2 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 488.03 |
| LogP ≤ 5 | 3.25 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'}, {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|