C6F14 — CID 9639
1,1,1,2,2,3,3,4,4,5,5,6,6,6-tetradecafluorohexane (PubChem CID 9639) has the molecular formula C6F14 and a molecular weight of 338.04 g/mol. Its IUPAC name is 1,1,1,2,2,3,3,4,4,5,5,6,6,6-tetradecafluorohexane.
| Compound Name | 1,1,1,2,2,3,3,4,4,5,5,6,6,6-tetradecafluorohexane |
|---|---|
| PubChem CID | 9639 |
| Molecular Formula | C6F14 |
| Molecular Weight | 338.04 g/mol |
| Exact Mass | 337.98 |
| IUPAC Name | 1,1,1,2,2,3,3,4,4,5,5,6,6,6-tetradecafluorohexane |
| SMILES | FC(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)F |
| InChI | InChI=1S/C6F14/c7-1(8,3(11,12)5(15,16)17)2(9,10)4(13,14)6(18,19)20 |
| InChIKey | ZJIJAJXFLBMLCK-UHFFFAOYSA-N |
| XLogP | 4.65 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 338.04 |
| LogP ≤ 5 | 4.65 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|