C15H24ClN5O2 — CID 96500485
N-(2-acetamidoethyl)-2-[(2S)-2-(5-chloro-1,3-dimethylpyrazol-4-yl)pyrrolidin-1-yl]acetamide (PubChem CID 96500485) has the molecular formula C15H24ClN5O2 and a molecular weight of 341.84 g/mol. Its IUPAC name is N-(2-acetamidoethyl)-2-[(2S)-2-(5-chloro-1,3-dimethylpyrazol-4-yl)pyrrolidin-1-yl]acetamide.
| Compound Name | N-(2-acetamidoethyl)-2-[(2S)-2-(5-chloro-1,3-dimethylpyrazol-4-yl)pyrrolidin-1-yl]acetamide |
|---|---|
| PubChem CID | 96500485 |
| Molecular Formula | C15H24ClN5O2 |
| Molecular Weight | 341.84 g/mol |
| Exact Mass | 341.16 |
| IUPAC Name | N-(2-acetamidoethyl)-2-[(2S)-2-(5-chloro-1,3-dimethylpyrazol-4-yl)pyrrolidin-1-yl]acetamide |
| SMILES | CC(=O)NCCNC(=O)CN1CCC[C@H]1c1c(C)nn(C)c1Cl |
| InChI | InChI=1S/C15H24ClN5O2/c1-10-14(15(16)20(3)19-10)12-5-4-8-21(12)9-13(23)18-7-6-17-11(2)22/h12H,4-9H2,1-3H3,(H,17,22)(H,18,23)/t12-/m0/s1 |
| InChIKey | BDUUIXAZEGARIH-LBPRGKRZSA-N |
| XLogP | 0.77 |
| TPSA | 79.26 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 341.84 |
| LogP ≤ 5 | 0.77 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|