C17H20N4O5S2 — CID 96514639
N-[(S)-cyclopropyl(1,3-thiazol-2-yl)methyl]-4-morpholin-4-ylsulfonyl-2-nitroaniline (PubChem CID 96514639) has the molecular formula C17H20N4O5S2 and a molecular weight of 424.50 g/mol. Its IUPAC name is N-[(S)-cyclopropyl(1,3-thiazol-2-yl)methyl]-4-morpholin-4-ylsulfonyl-2-nitroaniline.
| Compound Name | N-[(S)-cyclopropyl(1,3-thiazol-2-yl)methyl]-4-morpholin-4-ylsulfonyl-2-nitroaniline |
|---|---|
| PubChem CID | 96514639 |
| Molecular Formula | C17H20N4O5S2 |
| Molecular Weight | 424.50 g/mol |
| Exact Mass | 424.09 |
| IUPAC Name | N-[(S)-cyclopropyl(1,3-thiazol-2-yl)methyl]-4-morpholin-4-ylsulfonyl-2-nitroaniline |
| SMILES | O=[N+]([O-])c1cc(S(=O)(=O)N2CCOCC2)ccc1N[C@H](c1nccs1)C1CC1 |
| InChI | InChI=1S/C17H20N4O5S2/c22-21(23)15-11-13(28(24,25)20-6-8-26-9-7-20)3-4-14(15)19-16(12-1-2-12)17-18-5-10-27-17/h3-5,10-12,16,19H,1-2,6-9H2/t16-/m0/s1 |
| InChIKey | ZTYCMDOKNBJLLA-INIZCTEOSA-N |
| XLogP | 2.64 |
| TPSA | 114.67 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 424.50 |
| LogP ≤ 5 | 2.64 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|