C20H30N2O3 — CID 96518413
1-[3-(oxan-4-yloxy)propyl]-3-[[(1S)-1,2,3,4-tetrahydronaphthalen-1-yl]methyl]urea (PubChem CID 96518413) has the molecular formula C20H30N2O3 and a molecular weight of 346.47 g/mol. Its IUPAC name is 1-[3-(oxan-4-yloxy)propyl]-3-[[(1S)-1,2,3,4-tetrahydronaphthalen-1-yl]methyl]urea.
| Compound Name | 1-[3-(oxan-4-yloxy)propyl]-3-[[(1S)-1,2,3,4-tetrahydronaphthalen-1-yl]methyl]urea |
|---|---|
| PubChem CID | 96518413 |
| Molecular Formula | C20H30N2O3 |
| Molecular Weight | 346.47 g/mol |
| Exact Mass | 346.23 |
| IUPAC Name | 1-[3-(oxan-4-yloxy)propyl]-3-[[(1S)-1,2,3,4-tetrahydronaphthalen-1-yl]methyl]urea |
| SMILES | O=C(NCCCOC1CCOCC1)NC[C@H]1CCCc2ccccc21 |
| InChI | InChI=1S/C20H30N2O3/c23-20(21-11-4-12-25-18-9-13-24-14-10-18)22-15-17-7-3-6-16-5-1-2-8-19(16)17/h1-2,5,8,17-18H,3-4,6-7,9-15H2,(H2,21,22,23)/t17-/m1/s1 |
| InChIKey | ZPBUVFDCWGDORZ-QGZVFWFLSA-N |
| XLogP | 2.99 |
| TPSA | 59.59 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 346.47 |
| LogP ≤ 5 | 2.99 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|