C17H18N2O3S — CID 96528135
[(3S)-1-benzoylpiperidin-3-yl]methyl 1,3-thiazole-4-carboxylate (PubChem CID 96528135) has the molecular formula C17H18N2O3S and a molecular weight of 330.41 g/mol. Its IUPAC name is [(3S)-1-benzoylpiperidin-3-yl]methyl 1,3-thiazole-4-carboxylate.
| Compound Name | [(3S)-1-benzoylpiperidin-3-yl]methyl 1,3-thiazole-4-carboxylate |
|---|---|
| PubChem CID | 96528135 |
| Molecular Formula | C17H18N2O3S |
| Molecular Weight | 330.41 g/mol |
| Exact Mass | 330.10 |
| IUPAC Name | [(3S)-1-benzoylpiperidin-3-yl]methyl 1,3-thiazole-4-carboxylate |
| SMILES | O=C(OC[C@H]1CCCN(C(=O)c2ccccc2)C1)c1cscn1 |
| InChI | InChI=1S/C17H18N2O3S/c20-16(14-6-2-1-3-7-14)19-8-4-5-13(9-19)10-22-17(21)15-11-23-12-18-15/h1-3,6-7,11-13H,4-5,8-10H2/t13-/m0/s1 |
| InChIKey | BGBHQSXQWQHKNH-ZDUSSCGKSA-N |
| XLogP | 2.85 |
| TPSA | 59.50 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 330.41 |
| LogP ≤ 5 | 2.85 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |