C15H16N2O2S — CID 95635068
[(3R)-1-phenylpyrrolidin-3-yl]methyl 1,3-thiazole-4-carboxylate (PubChem CID 95635068) has the molecular formula C15H16N2O2S and a molecular weight of 288.37 g/mol. Its IUPAC name is [(3R)-1-phenylpyrrolidin-3-yl]methyl 1,3-thiazole-4-carboxylate.
| Compound Name | [(3R)-1-phenylpyrrolidin-3-yl]methyl 1,3-thiazole-4-carboxylate |
|---|---|
| PubChem CID | 95635068 |
| Molecular Formula | C15H16N2O2S |
| Molecular Weight | 288.37 g/mol |
| Exact Mass | 288.09 |
| IUPAC Name | [(3R)-1-phenylpyrrolidin-3-yl]methyl 1,3-thiazole-4-carboxylate |
| SMILES | O=C(OC[C@@H]1CCN(c2ccccc2)C1)c1cscn1 |
| InChI | InChI=1S/C15H16N2O2S/c18-15(14-10-20-11-16-14)19-9-12-6-7-17(8-12)13-4-2-1-3-5-13/h1-5,10-12H,6-9H2/t12-/m1/s1 |
| InChIKey | ZIIXMXHPSQNALO-GFCCVEGCSA-N |
| XLogP | 2.83 |
| TPSA | 42.43 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 288.37 |
| LogP ≤ 5 | 2.83 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |