C20H28N2O3 — CID 95635064
[(3S)-1-phenylpyrrolidin-3-yl]methyl (2S)-1-butanoylpyrrolidine-2-carboxylate (PubChem CID 95635064) has the molecular formula C20H28N2O3 and a molecular weight of 344.45 g/mol. Its IUPAC name is [(3S)-1-phenylpyrrolidin-3-yl]methyl (2S)-1-butanoylpyrrolidine-2-carboxylate.
| Compound Name | [(3S)-1-phenylpyrrolidin-3-yl]methyl (2S)-1-butanoylpyrrolidine-2-carboxylate |
|---|---|
| PubChem CID | 95635064 |
| Molecular Formula | C20H28N2O3 |
| Molecular Weight | 344.45 g/mol |
| Exact Mass | 344.21 |
| IUPAC Name | [(3S)-1-phenylpyrrolidin-3-yl]methyl (2S)-1-butanoylpyrrolidine-2-carboxylate |
| SMILES | CCCC(=O)N1CCC[C@H]1C(=O)OC[C@H]1CCN(c2ccccc2)C1 |
| InChI | InChI=1S/C20H28N2O3/c1-2-7-19(23)22-12-6-10-18(22)20(24)25-15-16-11-13-21(14-16)17-8-4-3-5-9-17/h3-5,8-9,16,18H,2,6-7,10-15H2,1H3/t16-,18-/m0/s1 |
| InChIKey | DXSPLYGSGWPTSH-WMZOPIPTSA-N |
| XLogP | 2.85 |
| TPSA | 49.85 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 344.45 |
| LogP ≤ 5 | 2.85 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |