C19H25N3O4S — CID 96529621
3-(2,4-dioxoquinazolin-1-yl)-N-[(1S,3R)-3-[(R)-ethylsulfinyl]cyclohexyl]propanamide (PubChem CID 96529621) has the molecular formula C19H25N3O4S and a molecular weight of 391.49 g/mol. Its IUPAC name is 3-(2,4-dioxoquinazolin-1-yl)-N-[(1S,3R)-3-[(R)-ethylsulfinyl]cyclohexyl]propanamide.
| Compound Name | 3-(2,4-dioxoquinazolin-1-yl)-N-[(1S,3R)-3-[(R)-ethylsulfinyl]cyclohexyl]propanamide |
|---|---|
| PubChem CID | 96529621 |
| Molecular Formula | C19H25N3O4S |
| Molecular Weight | 391.49 g/mol |
| Exact Mass | 391.16 |
| IUPAC Name | 3-(2,4-dioxoquinazolin-1-yl)-N-[(1S,3R)-3-[(R)-ethylsulfinyl]cyclohexyl]propanamide |
| SMILES | CC[S@@](=O)[C@@H]1CCC[C@H](NC(=O)CCn2c(=O)[nH]c(=O)c3ccccc32)C1 |
| InChI | InChI=1S/C19H25N3O4S/c1-2-27(26)14-7-5-6-13(12-14)20-17(23)10-11-22-16-9-4-3-8-15(16)18(24)21-19(22)25/h3-4,8-9,13-14H,2,5-7,10-12H2,1H3,(H,20,23)(H,21,24,25)/t13-,14+,27+/m0/s1 |
| InChIKey | DXTGYJOZNNJUJA-JDBVMXIESA-N |
| XLogP | 1.28 |
| TPSA | 101.03 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 391.49 |
| LogP ≤ 5 | 1.28 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |