C18H21ClN4O3 — CID 96529873
N'-[(S)-(4-chlorophenyl)-cyclopropylmethyl]-N-[1-(2-methoxyethyl)pyrazol-3-yl]oxamide (PubChem CID 96529873) has the molecular formula C18H21ClN4O3 and a molecular weight of 376.84 g/mol. Its IUPAC name is N'-[(S)-(4-chlorophenyl)-cyclopropylmethyl]-N-[1-(2-methoxyethyl)pyrazol-3-yl]oxamide.
| Compound Name | N'-[(S)-(4-chlorophenyl)-cyclopropylmethyl]-N-[1-(2-methoxyethyl)pyrazol-3-yl]oxamide |
|---|---|
| PubChem CID | 96529873 |
| Molecular Formula | C18H21ClN4O3 |
| Molecular Weight | 376.84 g/mol |
| Exact Mass | 376.13 |
| IUPAC Name | N'-[(S)-(4-chlorophenyl)-cyclopropylmethyl]-N-[1-(2-methoxyethyl)pyrazol-3-yl]oxamide |
| SMILES | COCCn1ccc(NC(=O)C(=O)N[C@H](c2ccc(Cl)cc2)C2CC2)n1 |
| InChI | InChI=1S/C18H21ClN4O3/c1-26-11-10-23-9-8-15(22-23)20-17(24)18(25)21-16(12-2-3-12)13-4-6-14(19)7-5-13/h4-9,12,16H,2-3,10-11H2,1H3,(H,21,25)(H,20,22,24)/t16-/m0/s1 |
| InChIKey | NXATWRKZWVGFQQ-INIZCTEOSA-N |
| XLogP | 2.39 |
| TPSA | 85.25 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 376.84 |
| LogP ≤ 5 | 2.39 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|