C21H19F2N3O4 — CID 96530102
(8aR)-7-[4-(3,4-difluorophenoxy)benzoyl]-2-ethyl-5,6,8,8a-tetrahydroimidazo[1,5-a]pyrazine-1,3-dione (PubChem CID 96530102) has the molecular formula C21H19F2N3O4 and a molecular weight of 415.40 g/mol. Its IUPAC name is (8aR)-7-[4-(3,4-difluorophenoxy)benzoyl]-2-ethyl-5,6,8,8a-tetrahydroimidazo[1,5-a]pyrazine-1,3-dione.
| Compound Name | (8aR)-7-[4-(3,4-difluorophenoxy)benzoyl]-2-ethyl-5,6,8,8a-tetrahydroimidazo[1,5-a]pyrazine-1,3-dione |
|---|---|
| PubChem CID | 96530102 |
| Molecular Formula | C21H19F2N3O4 |
| Molecular Weight | 415.40 g/mol |
| Exact Mass | 415.13 |
| IUPAC Name | (8aR)-7-[4-(3,4-difluorophenoxy)benzoyl]-2-ethyl-5,6,8,8a-tetrahydroimidazo[1,5-a]pyrazine-1,3-dione |
| SMILES | CCN1C(=O)[C@H]2CN(C(=O)c3ccc(Oc4ccc(F)c(F)c4)cc3)CCN2C1=O |
| InChI | InChI=1S/C21H19F2N3O4/c1-2-25-20(28)18-12-24(9-10-26(18)21(25)29)19(27)13-3-5-14(6-4-13)30-15-7-8-16(22)17(23)11-15/h3-8,11,18H,2,9-10,12H2,1H3/t18-/m1/s1 |
| InChIKey | YPTCFLZWAPTYOH-GOSISDBHSA-N |
| XLogP | 2.87 |
| TPSA | 70.16 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 415.40 |
| LogP ≤ 5 | 2.87 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'hydantoin', 'substructure': 'N/A'} |
|---|