C11H16ClN3OS — CID 96532919
(2R)-2-butylsulfanyl-N-(6-chloropyridazin-3-yl)propanamide (PubChem CID 96532919) has the molecular formula C11H16ClN3OS and a molecular weight of 273.79 g/mol. Its IUPAC name is (2R)-2-butylsulfanyl-N-(6-chloropyridazin-3-yl)propanamide.
| Compound Name | (2R)-2-butylsulfanyl-N-(6-chloropyridazin-3-yl)propanamide |
|---|---|
| PubChem CID | 96532919 |
| Molecular Formula | C11H16ClN3OS |
| Molecular Weight | 273.79 g/mol |
| Exact Mass | 273.07 |
| IUPAC Name | (2R)-2-butylsulfanyl-N-(6-chloropyridazin-3-yl)propanamide |
| SMILES | CCCCS[C@H](C)C(=O)Nc1ccc(Cl)nn1 |
| InChI | InChI=1S/C11H16ClN3OS/c1-3-4-7-17-8(2)11(16)13-10-6-5-9(12)14-15-10/h5-6,8H,3-4,7H2,1-2H3,(H,13,15,16)/t8-/m1/s1 |
| InChIKey | PZDSVGVBYOAULQ-MRVPVSSYSA-N |
| XLogP | 2.99 |
| TPSA | 54.88 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 273.79 |
| LogP ≤ 5 | 2.99 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|