C13H25NO5S2 — CID 96533216
2-cyclopentylsulfonyl-N-[(2S)-1-ethylsulfonylpropan-2-yl]-N-methylacetamide (PubChem CID 96533216) has the molecular formula C13H25NO5S2 and a molecular weight of 339.48 g/mol. Its IUPAC name is 2-cyclopentylsulfonyl-N-[(2S)-1-ethylsulfonylpropan-2-yl]-N-methylacetamide.
| Compound Name | 2-cyclopentylsulfonyl-N-[(2S)-1-ethylsulfonylpropan-2-yl]-N-methylacetamide |
|---|---|
| PubChem CID | 96533216 |
| Molecular Formula | C13H25NO5S2 |
| Molecular Weight | 339.48 g/mol |
| Exact Mass | 339.12 |
| IUPAC Name | 2-cyclopentylsulfonyl-N-[(2S)-1-ethylsulfonylpropan-2-yl]-N-methylacetamide |
| SMILES | CCS(=O)(=O)C[C@H](C)N(C)C(=O)CS(=O)(=O)C1CCCC1 |
| InChI | InChI=1S/C13H25NO5S2/c1-4-20(16,17)9-11(2)14(3)13(15)10-21(18,19)12-7-5-6-8-12/h11-12H,4-10H2,1-3H3/t11-/m0/s1 |
| InChIKey | MGZKBMURQPEKLN-NSHDSACASA-N |
| XLogP | 0.63 |
| TPSA | 88.59 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 339.48 |
| LogP ≤ 5 | 0.63 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |