C14H27NO3S — CID 136534969
2-(4,4-dimethylcyclohexyl)sulfonyl-N,N-diethylacetamide (PubChem CID 136534969) has the molecular formula C14H27NO3S and a molecular weight of 289.44 g/mol. Its IUPAC name is 2-(4,4-dimethylcyclohexyl)sulfonyl-N,N-diethylacetamide.
| Compound Name | 2-(4,4-dimethylcyclohexyl)sulfonyl-N,N-diethylacetamide |
|---|---|
| PubChem CID | 136534969 |
| Molecular Formula | C14H27NO3S |
| Molecular Weight | 289.44 g/mol |
| Exact Mass | 289.17 |
| IUPAC Name | 2-(4,4-dimethylcyclohexyl)sulfonyl-N,N-diethylacetamide |
| SMILES | CCN(CC)C(=O)CS(=O)(=O)C1CCC(C)(C)CC1 |
| InChI | InChI=1S/C14H27NO3S/c1-5-15(6-2)13(16)11-19(17,18)12-7-9-14(3,4)10-8-12/h12H,5-11H2,1-4H3 |
| InChIKey | CSGPNHQQBFCIMP-UHFFFAOYSA-N |
| XLogP | 2.24 |
| TPSA | 54.45 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 289.44 |
| LogP ≤ 5 | 2.24 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |