About 2-(4,4-dimethylcyclohexyl)sulfonyl-N,N-diethylacetamide
2-(4,4-dimethylcyclohexyl)sulfonyl-N,N-diethylacetamide (PubChem CID 136534969) has the molecular formula C14H27NO3S
and a molecular weight of 289.44 g/mol. Its IUPAC name is 2-(4,4-dimethylcyclohexyl)sulfonyl-N,N-diethylacetamide.
Molecular Properties
| Compound Name | 2-(4,4-dimethylcyclohexyl)sulfonyl-N,N-diethylacetamide |
| PubChem CID | 136534969 |
| Molecular Formula | C14H27NO3S |
| Molecular Weight | 289.44 g/mol |
| Exact Mass | 289.17 |
| IUPAC Name | 2-(4,4-dimethylcyclohexyl)sulfonyl-N,N-diethylacetamide |
| SMILES | CCN(CC)C(=O)CS(=O)(=O)C1CCC(C)(C)CC1 |
| InChI | InChI=1S/C14H27NO3S/c1-5-15(6-2)13(16)11-19(17,18)12-7-9-14(3,4)10-8-12/h12H,5-11H2,1-4H3 |
| InChIKey | CSGPNHQQBFCIMP-UHFFFAOYSA-N |
| XLogP | 2.24 |
| TPSA | 54.45 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 19 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 289.44 |
| LogP ≤ 5 | 2.24 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 2-(4,4-dimethylcyclohexyl)sulfonyl-N,N-diethylacetamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-(4,4-dimethylcyclohexyl)sulfonyl-N,N-diethylacetamide?
The IUPAC name of 2-(4,4-dimethylcyclohexyl)sulfonyl-N,N-diethylacetamide (CID 136534969) is 2-(4,4-dimethylcyclohexyl)sulfonyl-N,N-diethylacetamide.
What is the SMILES notation for 2-(4,4-dimethylcyclohexyl)sulfonyl-N,N-diethylacetamide?
The canonical SMILES for 2-(4,4-dimethylcyclohexyl)sulfonyl-N,N-diethylacetamide is CCN(CC)C(=O)CS(=O)(=O)C1CCC(C)(C)CC1.
What is the InChIKey of 2-(4,4-dimethylcyclohexyl)sulfonyl-N,N-diethylacetamide?
The InChIKey is CSGPNHQQBFCIMP-UHFFFAOYSA-N. The full InChI is InChI=1S/C14H27NO3S/c1-5-15(6-2)13(16)11-19(17,18)12-7-9-14(3,4)10-8-12/h12H,5-11H2,1-4H3.
What are the key properties of 2-(4,4-dimethylcyclohexyl)sulfonyl-N,N-diethylacetamide?
2-(4,4-dimethylcyclohexyl)sulfonyl-N,N-diethylacetamide has a molecular weight of 289.44 g/mol, XLogP of 2.24, 5 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 2-(4,4-dimethylcyclohexyl)sulfonyl-N,N-diethylacetamide is sourced from PubChem (CID 136534969), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).