C12H23NO5S — CID 114233194
2-[2-(1,3-dioxan-2-yl)ethylsulfonyl]-N,N-diethylacetamide (PubChem CID 114233194) has the molecular formula C12H23NO5S and a molecular weight of 293.38 g/mol. Its IUPAC name is 2-[2-(1,3-dioxan-2-yl)ethylsulfonyl]-N,N-diethylacetamide.
| Compound Name | 2-[2-(1,3-dioxan-2-yl)ethylsulfonyl]-N,N-diethylacetamide |
|---|---|
| PubChem CID | 114233194 |
| Molecular Formula | C12H23NO5S |
| Molecular Weight | 293.38 g/mol |
| Exact Mass | 293.13 |
| IUPAC Name | 2-[2-(1,3-dioxan-2-yl)ethylsulfonyl]-N,N-diethylacetamide |
| SMILES | CCN(CC)C(=O)CS(=O)(=O)CCC1OCCCO1 |
| InChI | InChI=1S/C12H23NO5S/c1-3-13(4-2)11(14)10-19(15,16)9-6-12-17-7-5-8-18-12/h12H,3-10H2,1-2H3 |
| InChIKey | XWZMPAUZUNUPBD-UHFFFAOYSA-N |
| XLogP | 0.42 |
| TPSA | 72.91 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 293.38 |
| LogP ≤ 5 | 0.42 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |