C10H20N2O3 — CID 110369964
3-[2-(1,3-dioxolan-2-yl)ethyl]-1,1-diethylurea (PubChem CID 110369964) has the molecular formula C10H20N2O3 and a molecular weight of 216.28 g/mol. Its IUPAC name is 3-[2-(1,3-dioxolan-2-yl)ethyl]-1,1-diethylurea.
| Compound Name | 3-[2-(1,3-dioxolan-2-yl)ethyl]-1,1-diethylurea |
|---|---|
| PubChem CID | 110369964 |
| Molecular Formula | C10H20N2O3 |
| Molecular Weight | 216.28 g/mol |
| Exact Mass | 216.15 |
| IUPAC Name | 3-[2-(1,3-dioxolan-2-yl)ethyl]-1,1-diethylurea |
| SMILES | CCN(CC)C(=O)NCCC1OCCO1 |
| InChI | InChI=1S/C10H20N2O3/c1-3-12(4-2)10(13)11-6-5-9-14-7-8-15-9/h9H,3-8H2,1-2H3,(H,11,13) |
| InChIKey | LRGOFNSDHAMZRH-UHFFFAOYSA-N |
| XLogP | 0.80 |
| TPSA | 50.80 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 216.28 |
| LogP ≤ 5 | 0.80 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |