C7H12ClNO3 — CID 19032062
2-chloro-N-[2-(1,3-dioxolan-2-yl)ethyl]acetamide (PubChem CID 19032062) has the molecular formula C7H12ClNO3 and a molecular weight of 193.63 g/mol. Its IUPAC name is 2-chloro-N-[2-(1,3-dioxolan-2-yl)ethyl]acetamide.
| Compound Name | 2-chloro-N-[2-(1,3-dioxolan-2-yl)ethyl]acetamide |
|---|---|
| PubChem CID | 19032062 |
| Molecular Formula | C7H12ClNO3 |
| Molecular Weight | 193.63 g/mol |
| Exact Mass | 193.05 |
| IUPAC Name | 2-chloro-N-[2-(1,3-dioxolan-2-yl)ethyl]acetamide |
| SMILES | O=C(CCl)NCCC1OCCO1 |
| InChI | InChI=1S/C7H12ClNO3/c8-5-6(10)9-2-1-7-11-3-4-12-7/h7H,1-5H2,(H,9,10) |
| InChIKey | DTXOTVZTOMCKRD-UHFFFAOYSA-N |
| XLogP | 0.10 |
| TPSA | 47.56 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 193.63 |
| LogP ≤ 5 | 0.10 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|