About 1-(2,2-dimethylpropyl)-3-[2-(1,3-dioxan-2-yl)ethyl]urea
1-(2,2-dimethylpropyl)-3-[2-(1,3-dioxan-2-yl)ethyl]urea (PubChem CID 110669285) has the molecular formula C12H24N2O3
and a molecular weight of 244.33 g/mol. Its IUPAC name is 1-(2,2-dimethylpropyl)-3-[2-(1,3-dioxan-2-yl)ethyl]urea.
Molecular Properties
| Compound Name | 1-(2,2-dimethylpropyl)-3-[2-(1,3-dioxan-2-yl)ethyl]urea |
| PubChem CID | 110669285 |
| Molecular Formula | C12H24N2O3 |
| Molecular Weight | 244.33 g/mol |
| Exact Mass | 244.18 |
| IUPAC Name | 1-(2,2-dimethylpropyl)-3-[2-(1,3-dioxan-2-yl)ethyl]urea |
| SMILES | CC(C)(C)CNC(=O)NCCC1OCCCO1 |
| InChI | InChI=1S/C12H24N2O3/c1-12(2,3)9-14-11(15)13-6-5-10-16-7-4-8-17-10/h10H,4-9H2,1-3H3,(H2,13,14,15) |
| InChIKey | GIUDLWBUHWUFLT-UHFFFAOYSA-N |
| XLogP | 1.48 |
| TPSA | 59.59 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 17 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 244.33 |
| LogP ≤ 5 | 1.48 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 1-(2,2-dimethylpropyl)-3-[2-(1,3-dioxan-2-yl)ethyl]urea with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-(2,2-dimethylpropyl)-3-[2-(1,3-dioxan-2-yl)ethyl]urea?
The IUPAC name of 1-(2,2-dimethylpropyl)-3-[2-(1,3-dioxan-2-yl)ethyl]urea (CID 110669285) is 1-(2,2-dimethylpropyl)-3-[2-(1,3-dioxan-2-yl)ethyl]urea.
What is the SMILES notation for 1-(2,2-dimethylpropyl)-3-[2-(1,3-dioxan-2-yl)ethyl]urea?
The canonical SMILES for 1-(2,2-dimethylpropyl)-3-[2-(1,3-dioxan-2-yl)ethyl]urea is CC(C)(C)CNC(=O)NCCC1OCCCO1.
What is the InChIKey of 1-(2,2-dimethylpropyl)-3-[2-(1,3-dioxan-2-yl)ethyl]urea?
The InChIKey is GIUDLWBUHWUFLT-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H24N2O3/c1-12(2,3)9-14-11(15)13-6-5-10-16-7-4-8-17-10/h10H,4-9H2,1-3H3,(H2,13,14,15).
What are the key properties of 1-(2,2-dimethylpropyl)-3-[2-(1,3-dioxan-2-yl)ethyl]urea?
1-(2,2-dimethylpropyl)-3-[2-(1,3-dioxan-2-yl)ethyl]urea has a molecular weight of 244.33 g/mol, XLogP of 1.48, 4 rotatable bonds, 2 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 1-(2,2-dimethylpropyl)-3-[2-(1,3-dioxan-2-yl)ethyl]urea is sourced from PubChem (CID 110669285), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).