C15H21NO5 — CID 110370070
N-[2-(1,3-dioxan-2-yl)ethyl]-3,5-dimethoxybenzamide (PubChem CID 110370070) has the molecular formula C15H21NO5 and a molecular weight of 295.33 g/mol. Its IUPAC name is N-[2-(1,3-dioxan-2-yl)ethyl]-3,5-dimethoxybenzamide.
| Compound Name | N-[2-(1,3-dioxan-2-yl)ethyl]-3,5-dimethoxybenzamide |
|---|---|
| PubChem CID | 110370070 |
| Molecular Formula | C15H21NO5 |
| Molecular Weight | 295.33 g/mol |
| Exact Mass | 295.14 |
| IUPAC Name | N-[2-(1,3-dioxan-2-yl)ethyl]-3,5-dimethoxybenzamide |
| SMILES | COc1cc(OC)cc(C(=O)NCCC2OCCCO2)c1 |
| InChI | InChI=1S/C15H21NO5/c1-18-12-8-11(9-13(10-12)19-2)15(17)16-5-4-14-20-6-3-7-21-14/h8-10,14H,3-7H2,1-2H3,(H,16,17) |
| InChIKey | OTAYVROIKLVIHH-UHFFFAOYSA-N |
| XLogP | 1.59 |
| TPSA | 66.02 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 295.33 |
| LogP ≤ 5 | 1.59 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |