C11H24N2O3S — CID 112695679
N,N-diethyl-3-(2-ethylsulfonylethylamino)propanamide (PubChem CID 112695679) has the molecular formula C11H24N2O3S and a molecular weight of 264.39 g/mol. Its IUPAC name is N,N-diethyl-3-(2-ethylsulfonylethylamino)propanamide.
| Compound Name | N,N-diethyl-3-(2-ethylsulfonylethylamino)propanamide |
|---|---|
| PubChem CID | 112695679 |
| Molecular Formula | C11H24N2O3S |
| Molecular Weight | 264.39 g/mol |
| Exact Mass | 264.15 |
| IUPAC Name | N,N-diethyl-3-(2-ethylsulfonylethylamino)propanamide |
| SMILES | CCN(CC)C(=O)CCNCCS(=O)(=O)CC |
| InChI | InChI=1S/C11H24N2O3S/c1-4-13(5-2)11(14)7-8-12-9-10-17(15,16)6-3/h12H,4-10H2,1-3H3 |
| InChIKey | KVDXXCMDNYKOSW-UHFFFAOYSA-N |
| XLogP | 0.27 |
| TPSA | 66.48 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 264.39 |
| LogP ≤ 5 | 0.27 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|